| << Previous: Formal Grammar | Up: Table of Contents | Next: SMILES Output >> |
An atom is represented by its atomic symbol, enclosed in square brackets, [ ]. The first character of the symbol is uppercase and the second (if any) is lowercase, except that for aromatic atoms (see below), the first character is lowercase. There are 111 valid atomic symbols, as defined by IUPAC (see also Web Elements).
The symbol '*' is also accepted as a valid atomic symbol, and represents a "wildcard" or unknown atom.
Examples:
| [U] | Uranium |
| [Pb] | Lead |
| [He] | Helium |
| [*] | Unknown atom |
Hydrogens inside of brackets are specified as "Hn" where "n" is a number such as "H3". If no "Hn" is specified, it is identical to H0. If H is specified without a number, it is identical to H1. For example, [C] and [CH0] are identical, and [CH] and [CH1] are identical.
Hydrogens that are specified in brackets with this notation have undefined isotope, no chirality, no other bound hydrogen, neutral charge, and an undefined atom class.
Examples:
| [CH4] | methane | |
| [ClH] | hydrochloric acid | H1 implied |
| [ClH1] | hydrochloric acid |   |
A hydrogen atom cannot have a hydrogen count, for example, [HH1] is illegal. Hydrogens connected to other hydrogens must be represented as explicit atoms in square brackets. For example molecular hydrogen must be written as [H][H].
Question: are more than 9 hydrogens possible? Should they be supported?
Charge is specified by a "+n" or "-n" where "n" is a number; if the number is missing, it means either +1 or -1 as appropriate.
For backwards compatibility, a general-purpose SMILES parser should accept the symbols "--" and "++" to mean charges of -2 and +2, but this is a deprecated form and should be avoided.
Examples:
| [Cl-] | chloride anion | -1 charge, H0 implied |
| [OH1-] | hydroxyl anion | -1 charge, H1 |
| [OH-1] | hydroxyl anion | -1 charge, H1 |
| [Cu+2] | copper cation | +2 charge, H0 implied |
| [Cu++] | copper cation | +2 charge, H0 implied (deprecated form) |
Question: do we need to allow two-digit charges, like "+10"?
Isotopic specification is placed inside the square brackets for an atom preceeding the atomic symbol; for example:
| [13CH4] | methane-13C |
| [2H+] | deuterium ion |
| [238U] | uranium 238 atom |
An isotope is interpreted as a number, so that [2H], [02H] and [002H] all mean deuterium. If the isotope field is not specified then the atom is assumed to have the naturally-occuring isotopic ratios. The isotope value 0 also indicates an isotope of zero, that is [0S] is not the same as [S].
There is no requirement that the isotope is a genuine isotope of the element. Thus, [36Cl] is allowed even though 35Cl and 37Cl are the actual known stable isotopes of chlorine.
A general-purpose SMILES parser must accept at least three digits for the isotope and values from 0 to 999.
A special subset of elements called the "organic subset" of B, C, N,O, P, S, F, Cl, Br, I, and * (the "wildcard" atom) can be written using the only the atomic symbol (that is, without the square brackets, H-count, etc.). An atom is specified this way has the following properties:
The implicit hydrogen count is determined by summing the bond orders of the bonds connected to the atom. If that sum is equal to a known valence for the element or is greater than any known valence then the implicit hydrogen count is 0. Otherwise the implicit hydrogen count is the difference between that sum and the next highest known valence.
The "normal valence" for these elements is defined as:
| Element | Valence |
| B | 3 |
| C | 4 |
| N | 3 or 5 |
| O | 2 |
| P | 3 or 5 |
| S | 2, 4, or 6 |
| halogens | 1 |
| * | unspecified |
Examples:
| C | methane |
| N | ammonia |
| Cl | hydrochloric acid |
Note: The remaining atom properties, chirality and ring-closures, are discussed in later sections.
The '*' atom represents an atom whose atomic number is unknown or unspecified. If it occurs inside brackets, it can have its isotope, chirality, hydrogen count and charge specified. If it occurs outside of brackets, it has no assumed isotope, a mass of zero, unspecified chirality, a hydrogen count of zero, and a charge of zero.
| Oc1c(*)cccc1 | ortho-substituted phenol |
The '*' atom does not have any specific electronic properties or valence. If specified outside of square brackets, it takes on the valence implied by its bonds. If it is inside square brackets, it takes on the valence implied by its bonds, hydrogens and/or charge.
A '*' atom can be part of an aromatic ring. When deducing the aromaticity of a ring system, the ring system is considered aromatic if there is an element which could replace the '*' and make the ring system meet the aromaticity rules (see aromaticity, below).
An "atom class" is an arbitrary integer, a number that has no chemical meaning. It is used by applications to mark atoms in ways that are meaningful only to the application. Multiple atoms may be labeled with the same atom class.
The atom class is specified after all other properties in square brackets. For example:
| [CH4:2] | methane, atom's class is 2 |
If the atom class is not specified then the atom class is zero. The atom class is interpreted as a number, so both "[CH2:5]" and "[NH4+:005]" have an atom class of 5.
Atoms that are adjacent in a SMILES string are assumed to be joined by a single or aromatic bond (see aromaticity). For example:
| CC | ethane |
| CCO | ethanol |
| NCCCC | n-butylamine |
| CCCCN | n-butylamine |
Double, triple and quadruple bonds are represented by '=', '#', and '$' respectively:
| C=C | ethene |
| C#N | hydrogen cyanide |
| CC#CC | 2-Butyne |
| CCC=O | propanal |
| [Rh-](Cl)(Cl)(Cl)(Cl)$[Rh-](Cl)(Cl)(Cl)Cl | octachlorodirhenate (III) |
A single bond can be explicitely represented with '-', but it is rarely necessary.
| C-C | same as: CC |
| C-C-O | same as: CCO |
| C-C=C-C | same as: CC=CC |
Note: The remaining bond symbols, ":\/", are discussed in later sections.
An atom with three or more bonds is called a branched atom, and is represented using parentheses.
![]() | CCC(CC)CO | 2-Ethyl-1-butanol |
Branches can be nested or "stacked" to any depth:
![]() | CC(C)C(=O)C(C)C | 2,4-dimethyl-3-pentanone |
| pic here | OCC(CCC)C(C(C)C)CCC | 2-propyl-3-isopropyl-1-propanol |
![]() | OS(=O)(=S)O | thiosulfate |
The SMILES branch/chain rules allow nested parenthetical expressions (branches) to an arbitrary depth. For example, the following SMILES, though peculiar, is legal:
| C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C))))))))))))))))))))C | C22H46 |
In a SMILES string such as "C1CCCCC1", the first occurance of a ring-closure number (an "rnum") creates an "open bond" to the atom that preceeds the ring-closure number (the "rnum"). When that same rnum is encountered later in the string, a bond is made between the two atoms, which typically forms a cyclic structure.
![]() | C1CCCCC1 | cyclohexane |
![]() | N1CC2CCCC2CC1 | perhydroisoquinoline |
If a bond symbol is present between the atom and rnum, it can be present on either or both bonded atoms. However, if it appears on both bonded atoms, the two bond symbols must be the same.
![]() | C=1CCCCC=1 | cyclohexene |
| C=1CCCC1 | cyclohexene (preferred form) | |
| C1CCCC=1 | cyclohexene | |
| C-1CCCC=1 | invalid |
Ring closures must be matched pairs in a SMILES string, for example, "C1CCC" is not a valid SMILES.
It is permissable to re-use ring-closure numbers. Once a particular number has been encountered twice, that number is available again for subsequent ring closures.
![]() |
C1CCCCC1C1CCCCC1 | dicyclohexyl | both SMILES are valid |
| C1CCCCC1C2CCCCC2 | dicyclohexyl |
Note that the ring number zero is valid, for example cyclohexane can be written "C0CCCCC0".
Two-digit ring numbers are permitted, but must be preceeded by the percent "%" symbol, such as "C%25CCCCC%25" for cyclohexane. Three-digit numbers and larger are never permitted. However, note that three digits are not invalid; for example, "C%123" is the same as "C3%12", that is, an atom with two rnum specifications.
The digit(s) representing a ring-closure are interpreted as a number, not a symbol, and two rnums match if their numbers match. Thus, C1CCCCC%01 is a valid SMILES and is the same as C1CCCCC1. Likewise, C%00CCCCC%00 is a valid SMILES.
A single atom can have several ring-closure numbers, such as this spiro atom:
![]() | C12(CCCCC1)CCCCC2 | spiro[5.5]undecane |
Two atoms cannot be joined by more than one bond, and an atom cannot be bonded to itself. For example, the following are not allowed:
| C12CCCCC12 | illegal, two bonds between one pair of atoms |
| C12C2CCC1 | illegal, two bonds between one pair of atoms |
| C11 | illegal, atom bonded to itself |
"Aromaticity" in SMILES is primarily for cheminformatics purposes. In a cheminformatics system, we'd like to have a single representation for each molecule. The Kekulé form masks the inherent uniformity of the bonds in an aromatic ring. SMILES uses a simplified definition of aromaticity that facilitates substructure and exact-structure searches, as well as normalization and canonicalization of SMILES.
The definition of "aromaticity" in SMILES is not intended to imply anything about the physical or chemical properties of a substance. In many or most cases, the SMILES definition of aromaticity will match the chemist's notion of what is aromatic, but in some cases it will not.
Aromaticity can be represented in one of two ways in a SMILES.
A lowercase aromatic symbol is defined as an atom in the sp2 configuration in an aromatic or anti-aromatic ring system. For example:
![]() | c1ccccc1 C1=CC=CC=C1 | benzene |
![]() | c1ccc2CCCc2c1 C1=CC=CC(CCC2)=C12 | indane |
![]() | c1occc1 C1OC=CC=C1 | furan |
![]() | c1ccc1 C1=CC=C1 | cyclobutadiene |
The Kekulé form is always acceptable for SMILES input. For output, the aromatic form (using lowercase letters) is preferred. The lowercase symbols eliminate the arbitrary choice of how to assign the single and double bonds, and provide a normalized form that more accurately reflects the electronic configuration.
THIS SECTION IS UNDER MAJOR REVISION, AND AT THIS POINT IS ONLY FOR DISCUSSION PURPOSES.
This proposed section is an attempt to simplify the rule-based system by enumerating all atom/bond configurations that are known to participate in aromatic systems.
A single, isolated ring that meets the following criteria is aromatic:
Each element that can participate in an aromatic ring is defined to have the following number of π electrons:
| configuration | π electrons | Example | |
|
1 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
0-1 | ![]() |
c1ccccc1 |
|
0 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
1-2 | ![]() |
c1ccccc1 |
|
1 | ![]() |
c1ccccc1 |
|
2 | ![]() |
c1ccccc1 |
|
2 | ![]() |
c1ccccc1 |
|
2 | ![]() |
c1ccccc1 |
In an aromatic system, all of the aromatic atoms must be sp2 hybridized, and the number of Pi electrons must meet Hückel's 4N+2 criterion. When parsing a SMILES, a parser must note the aromatic designation of each atom on input, then when the parsing is complete, the SMILES software must verify that electrons can be assigned without violating the valence rules, consistent with the sp2 markings, the specified or implied hydrogens, external bonds, and charges on the atoms.
The aromatic-bond symbol ':' can be used between aromatic atoms, but it is never necessary; a bond between two aromatic atoms is assumed to be aromatic unless it is explicitely represented as a single bond '-'. However, a single bond (nonaromatic bond) between two aromatic atoms must be explicitely represented. For example:
![]() |
c1ccccc1-c2ccccc2 | biphenyl |
Note: Some SMILES parsers interpret a lowercase letter as sp2 anywhere it appears; for example, CccccC would be interpreted as CC=CC=CC. The OpenSMILES specification does not allow this interpretation unless nonstandard parsing is explicitely allowed by the user.
Hydrogens in a SMILES can be represented in three different ways:
| implicit hydrogen | C | methane | h-count deduced from normal valence (4) |
| atom property | [CH4] | methane | h-count specified for heavy atom |
| explicit hydrogens | [H]C([H])([H])[H] | methane | hydrogens represented as normal atoms |
All three forms are equivalent. However, some situations require that one form must be used:
A hydrogen that meets one of the following criteria must be represented as an explicit atom:
It is permissible to use a mixture of an atom h-count and explicit hydrogen. In such a case, the atom's hydrogen count is the sum of the atomic h-count property and the number of attached hydrogens. For example:
| [CH4] | methane |
| [H][CH2][H] | methane |
| [2H][CH2]C | deuteroethane |
The dot '.' symbol (also called a "dot bond") is legal most places where a bond symbol would occur, but indicates that the atoms are not bonded. The most common use of the dot-bond symbol is to represent disconnected and ionic compounds.
![]() | [Na+].[Cl-] | sodium chloride |
![]() | Oc1ccccc1.NCCO | phenol, 2-amino ethanol |
![]() | [NH4+].[NH4+].[O-]S(=O)(=O)[S-] | diammonium thiosulfate |
The dot can appear most places that a bond symbol is allowed, for example, the phenol example above can also be written:
![]() | c1cc(O.NCCO)ccc1 | phenol, 2-amino ethanol |
| Oc1cc(.NCCO)ccc1 | phenol, 2-amino ethanol |
The second example above is an odd, but legal, use of parentheses and the dot bond, since the syntax allows a dot most places a regular bond could appear (the exception is that a dot can't appear before a ring-closure digit).
Although dot-bonds are commonly used to represent compounds with disconnected parts, a dot-bond does not in itself mean that there are disconnected parts in the compound. See the following section regarding ring digits for some examples that illustrate this.
The dot bond cannot be used in front of a ring-closure digit. For example, C.1CCCCC.1 is illegal.
A ring-number specifications ("rnum") is most commonly used to specify a ring-closure bond, but when used with the "." dot-bond symbol, it can also specify a non-ring bond. Two rnums in a SMILES mean that the two atoms that preceed the rnums are bonded. A dot-bond "." means that the atoms to which it is adjacent in the SMILES string are not bonded to each other. By combining these two constructs, one can "piece together" fragments of SMILES into a whole molecule. The following SMILES illustrate this:
| CC | C1.C1 | ethane |
| CCC | C1.C12.C2 | propane |
![]() | c1c2c3c4cc1.Br2.Cl3.Cl4 | 1-bromo-2,3-dichlorobenzene |
This feature of SMILES provides a convenient method of enumerating the molecules of a combinatorial library using string concatenation.
A SMILES string can specify the cis/trans configuration around a double bond, and can specify the chiral configuration of specific atoms in a molecule.
SMILES strings do not represent all types of stereochemistry. Examples of stereochemistry that cannot be encoded into a SMILES include:
SMILES uses an atom-centered chirality specification, in which the atom's left-to-right order in the SMILES string itself is used as the basis for the chirality marking.
| Tetrahedral Chirality | |
| look from N toward C (chiral center)... | list the neighbors anticlockwise |
![]() |
N[C@](Br)(O)C |
| ...or clockwise | |
| N[C@@](Br)(C)O | |
For the structure above, starting with the nitrogen atom, one "looks" toward the chiral center. The the remaining three neighbor atoms are written by listing them in anticlockwise order using the '@' chiral property on the atom, or in clockwise order using the '@@' chiral property, as illustrated above. The '@' symbol is a "visual mnemonic" in that the spiral around the character goes in the anticlockwise direction, and means "anticlockwise" in the SMILES string (thus, '@@' can be thought of as anti-anti-clockwise).
A chiral center can be written starting from any of its neighbor atoms, and the choice of whether to list the remaining neighbor in clockwise or anticlockwise order is also arbitrary. The following SMILES are all equivalent and all specify the exact same chiral center illustrated above:
| N[C@](Br)(O)C | Br[C@](O)(N)C |
| O[C@](Br)(C)N | Br[C@](C)(O)N |
| C[C@](Br)(N)O | Br[C@](N)(C)O |
| C[C@@](Br)(O)N | Br[C@@](N)(O)C |
If one of the neighbor atoms is a hydrogen and is represented as an atomic property of the chiral center (rather than explicitely as [H]), then it is considered to be the first atom in the clockwise or anticlockwise accounting. For example, if we replaced the bromine in the illustration above with a hydrogen atom, its SMILES would be:
| N[C@H](O)C |
The configuration of atoms around double bonds is specified by the bond symbols '/' and '\'. These symbols always come in pairs, and indicate cis or trans with a visual "same side" or "opposite side" concept. That is:
![]() |
F/C=C/F F\C=C\F |
trans-difluoroethene (both SMILES are equivalent) |
![]() |
F\C=C/F F/C=C\F |
cis-difluoroethene (both SMILES are equivalent) |
The "visual interpretation" of the '/' and '\' symbol is that they are thought of as bonds that "point" above or below the allenal carbon. That is, "F/C=C/Br" means "The F is below the first carbon, and the Br is above the second carbon," leading to the interpretation of a trans configuration.
This notation can be confusing when parentheses follow one of the allenal carbons:
|
F/C=C/F C(\F)=C/F |
trans-difluoroethene |
|
F\C=C/F C(/F)=C/F |
cis-difluoroethene |
The "visual interpretation" of the "up-ness" or "down-ness" of each single bond is relative to the carbon atom, not the double bond, so the sense of the symbol changes when the fluorine atom moved from the left to the right side of the allenal carbon atom.
Note: This point was not well documented in earlier SMILES specifications, and several SMILES interpreters are known to interpret the '/' and '\' symbols incorrectly.
A SMILES with conflicting up/down specifications is invalid:
| C/C(\F)=C/F | Invalid SMILES: Both the methyl and fluorine are "down" relative to the first allenal carbon. |
It is permissible, but not required, that every atom attached to a double bond be marked. As long as at least two neighbor atoms, one on each end of the double bond, is marked, the "up-ness" or "down-ness" of the unmarked neighbors can be deduced.
| F/C(C)=C/F | trans-difluoro configuration, position of methyl is implied |
Extended cis and trans configurations can be specified for conjugated allenes with an odd number of double bonds:
| F/C=C=C=C/F | trans-difluorobutatriene |
| F/C=C=C=C\F | cis-difluorobutatriene |
Extended tetrahedral configurations can be specified for conjugated allenes with an even number of double bonds. The normal tetrahedral rules using '@' and '@@' apply, but the "neighbor" atoms to which the chirality refers are at the ends of the allenal system. For example:
![]() | NC(Br)=[C@]=C(O)C |
To determine the correct clockwise or anticlockwise specification, the allene is conceptually "collapsed" into a single tetrahedral chiral center, and the resulting chirality is marked as a property of the center atom of the extended allene system.
SMILES allows partial stereochemical specifications. It is permissible for some chiral centers or double bonds to have stereochemical markings in the SMILES, while others in the same SMILES string do not. For example:
| F/C=C/C/C=C\C | completely specified |
| F/C=C/CC=CC | partially specified |
| N1[C@H](Cl)[C@@H](Cl)C(Cl)CC1 | partially specified |
The SMILES language supports a number of atom-centered chiral configurations:
TH Tetrahedral AL Allenal SP Square Planar TB Trigonal Bipyramidal OH Octahedral
The shorthand notations '@' and '@@' correspond to clockwise and anti-clockwise tetrahedral chirality, and are the same a '@TH1' and '@TH2', respectively. Likewise, in an allenal configuration, the shorthand notations '@' and '@@' correspond to '@AL1' and '@AL2', respectively.
Very few SMILES systems actually implement the rules for SP, TB or OH chirality.
NEED COMPLETE DOCUMENTATION for SP, TB and OH.
A SMILES string is terminated by a whitespace terminator character (space, tab, newline, carriage-return), or by the end of the string.
Other data or information, such as a name, properties, registration number, etc., may follow the SMILES on a line after the whitespace character. SMILES parsers will ignore this data, although applications that use the SMILES parser will often make use of it.
OpenSMILES is designed to facilitate exchange of chemical information. To achieve that goal, it SMILES parsers should impose as few limits as possible on the language.
There is no formal limit to the length of a SMILES string; SMILES of over 1 million characters have been assembled for various purposes. There is no requirement that a SMILES parser must be able to parse these exceptionally long SMILES, but as a guideline, all implementations of SMILES parsers should, at a minimum, accept and correctly parse SMILES strings of 100,000 characters. If a SMILES parser encounters a string that is too long to parse, it should generate a relevant error message.
A SMILES parser should accept at least four digits for the atom class, and the values 0 to 9999.
There is no formal limit to the number of rings a molecule can contain. There are only 100 ring-closure numbers, but since numbers can be reused, a molecule can potentially have more than 100 rings. SMILES parsers should accept and correctly parse molecules with at least 1000 rings; it is preferable to place no limits on the number of rings a molecule can contain.
Branches (parentheses) can be nested to an arbitrary depth. Some SMILES strings in standard databases contain over 30 levels of branches, and much deeper nesting is possible. A general purpose parser must handle at least 100 levels; it is preferrable to place no limits on nesting depth for parentheses.
There is no formal limit on the number of bonds an atom can have. SMILES parsers should allow at least ten bonds to each atom; it is preferrable to place no limits on the number of bonds to each atom.
There is no limit to the number of "dot-disconnected" fragments in a SMILES. A SMILES of 100,000 atoms could in principle contain no bonds at all; SMILES parsers should place no limits on the number of fragments allowed (except that it is limited to the number of atoms the parser can manage).
Programmers are strongly encouraged to provide detailed and clear error messages. If possible, the error message should show exactly which character or "phrase" of the SMILES string triggered the error message.
| << Previous: Formal Grammar | Up: Table of Contents | Next: SMILES Output >> |
Copyright © 2007, Craig A. James
Content is available under GNU Free Documentation License 1.2